For research use only. Not for therapeutic Use.
RTICBM-189（Cat No.:I045161）is a potent and selective inhibitor of monoacylglycerol lipase (MAGL), the key enzyme responsible for hydrolyzing monoacylglycerols to free fatty acids, including the endocannabinoid 2-arachidonoylglycerol (2-AG). By blocking MAGL activity, RTICBM-189 elevates 2-AG levels, modulating cannabinoid receptor signaling and producing anti-inflammatory, analgesic, and neuroprotective effects. This compound is valuable for studying endocannabinoid system regulation, lipid metabolism, and their roles in pain, neurodegeneration, and inflammatory disorders. Its high potency and specificity make RTICBM-189 a promising candidate in preclinical research on cannabinoid-based therapeutic strategies.
| CAS Number | 551909-15-0 |
| Synonyms | 1-(4-chlorophenyl)-3-[2-(3-chlorophenyl)ethyl]urea |
| Molecular Formula | C15H14Cl2N2O |
| Purity | ≥95% |
| IUPAC Name | 1-(4-chlorophenyl)-3-[2-(3-chlorophenyl)ethyl]urea |
| InChI | InChI=1S/C15H14Cl2N2O/c16-12-4-6-14(7-5-12)19-15(20)18-9-8-11-2-1-3-13(17)10-11/h1-7,10H,8-9H2,(H2,18,19,20) |
| InChIKey | PPKIPROVSKBYAT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)CCNC(=O)NC2=CC=C(C=C2)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
