For research use only. Not for therapeutic Use.
RSC133（Cat No.:R022238）is a selective inhibitor of the protein kinase CK2 (casein kinase 2), an enzyme involved in regulating various cellular processes, including cell growth, survival, and DNA repair. CK2 is often overexpressed in cancer cells, contributing to tumor progression and resistance to therapy. By inhibiting CK2, RSC133 has the potential to disrupt key signaling pathways that promote cancer cell proliferation and survival. This compound is being investigated for its therapeutic potential in cancer treatment, as it may enhance the effectiveness of other therapies by targeting CK2-driven signaling in malignancies.
| CAS Number | 1418131-46-0 |
| Synonyms | 3-[[(E)-3-(1H-indol-3-yl)prop-2-enoyl]amino]benzamide |
| Molecular Formula | C18H15N3O2 |
| Purity | ≥95% |
| IUPAC Name | 3-[[(E)-3-(1H-indol-3-yl)prop-2-enoyl]amino]benzamide |
| InChI | InChI=1S/C18H15N3O2/c19-18(23)12-4-3-5-14(10-12)21-17(22)9-8-13-11-20-16-7-2-1-6-15(13)16/h1-11,20H,(H2,19,23)(H,21,22)/b9-8+ |
| InChIKey | HYUDSQGICKAEGE-CMDGGOBGSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)/C=C/C(=O)NC3=CC=CC(=C3)C(=O)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
