For research use only. Not for therapeutic Use.
(RS)-APICA（Cat No.:I010269）is a synthetic compound and a potent, selective agonist of the GPR55 receptor, which is part of the endocannabinoid system. GPR55 has been implicated in various physiological processes, including pain sensation, inflammation, and cancer progression. By activating GPR55, (RS)-APICA can modulate these pathways, potentially offering therapeutic benefits in managing pain, neuroinflammation, and certain types of cancer. Its specificity for GPR55 makes it a promising candidate for research into new treatments targeting the endocannabinoid system and related disorders, without affecting other receptor systems.
| CAS Number | 170847-18-4 |
| Synonyms | 1-amino-5-phosphono-2,3-dihydroindene-1-carboxylic acid |
| Molecular Formula | C10H12NO5P |
| Purity | ≥95% |
| IUPAC Name | 1-amino-5-phosphono-2,3-dihydroindene-1-carboxylic acid |
| InChI | InChI=1S/C10H12NO5P/c11-10(9(12)13)4-3-6-5-7(17(14,15)16)1-2-8(6)10/h1-2,5H,3-4,11H2,(H,12,13)(H2,14,15,16) |
| InChIKey | ZNQZXIHSJUDIKL-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C1C=C(C=C2)P(=O)(O)O)(C(=O)O)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
