For research use only. Not for therapeutic Use.
(R,R)-GSK321（Cat No.:I044326）is a selective small-molecule inhibitor of BET (bromodomain and extraterminal domain) proteins, particularly targeting BRD4, which regulates gene expression by recognizing acetylated lysine residues on histone tails. As an epigenetic modulator, (R,R)-GSK321 disrupts protein–chromatin interactions, leading to downregulation of oncogenes like MYC, making it valuable in cancer research. The (R,R) stereoisomeric form ensures high binding specificity and potency. It is widely used in studies exploring transcriptional regulation, inflammation, and potential therapeutic strategies in hematological malignancies, solid tumors, and inflammatory diseases driven by BET protein dysregulation.
| CAS Number | 1816272-19-1 |
| Synonyms | (7R)-1-[(4-fluorophenyl)methyl]-N-[3-[(1R)-1-hydroxyethyl]phenyl]-7-methyl-5-(1H-pyrrole-2-carbonyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-3-carboxamide |
| Molecular Formula | C28H28FN5O3 |
| Purity | ≥95% |
| IUPAC Name | (7R)-1-[(4-fluorophenyl)methyl]-N-[3-[(1R)-1-hydroxyethyl]phenyl]-7-methyl-5-(1H-pyrrole-2-carbonyl)-6,7-dihydro-4H-pyrazolo[4,3-c]pyridine-3-carboxamide |
| InChI | InChI=1S/C28H28FN5O3/c1-17-14-33(28(37)24-7-4-12-30-24)16-23-25(27(36)31-22-6-3-5-20(13-22)18(2)35)32-34(26(17)23)15-19-8-10-21(29)11-9-19/h3-13,17-18,30,35H,14-16H2,1-2H3,(H,31,36)/t17-,18-/m1/s1 |
| InChIKey | IVFDDVKCCBDPQZ-QZTJIDSGSA-N |
| SMILES | C[C@@H]1CN(CC2=C1N(N=C2C(=O)NC3=CC=CC(=C3)[C@@H](C)O)CC4=CC=C(C=C4)F)C(=O)C5=CC=CN5 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
