For research use only. Not for therapeutic Use.
(R,R)-CPI-1612(CAT: I040632) is a potent and selective inhibitor of CREB-binding protein (CBP)/p300 histone acetyltransferases (HATs), enzymes that regulate gene expression through acetylation of histones and non-histone proteins. The (R,R)-enantiomer exhibits high affinity and specificity, making it a valuable chemical probe for studying epigenetic transcriptional regulation. By blocking CBP/p300 activity, (R,R)-CPI-1612 modulates oncogenic and developmental gene programs, showing promise in cancer research, especially in hormone-driven cancers such as breast and prostate cancer. It is widely used to investigate chromatin remodeling, enhancer function, and transcription factor activity.
| CAS Number | 2374972-35-5 |
| Synonyms | (2R)-2-[[(2R)-2-(4-cyanophenyl)propyl]amino]-N-[5-(1-methylpyrazol-4-yl)pyridin-2-yl]-2-phenylacetamide |
| Molecular Formula | C27H26N6O |
| Purity | ≥95% |
| IUPAC Name | (2R)-2-[[(2R)-2-(4-cyanophenyl)propyl]amino]-N-[5-(1-methylpyrazol-4-yl)pyridin-2-yl]-2-phenylacetamide |
| InChI | InChI=1S/C27H26N6O/c1-19(21-10-8-20(14-28)9-11-21)15-30-26(22-6-4-3-5-7-22)27(34)32-25-13-12-23(16-29-25)24-17-31-33(2)18-24/h3-13,16-19,26,30H,15H2,1-2H3,(H,29,32,34)/t19-,26+/m0/s1 |
| InChIKey | SEDFZSHSBUXKAC-AFMDSPMNSA-N |
| SMILES | CC(CNC(C1=CC=CC=C1)C(=O)NC2=NC=C(C=C2)C3=CN(N=C3)C)C4=CC=C(C=C4)C#N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
