For research use only. Not for therapeutic Use.
Rosarin(CAT: R072704) is a cinnamyl alcohol glycoside isolated from Rhodiola rosea, an adaptogenic plant traditionally used to enhance resilience against physical and mental stress. As one of the characteristic marker compounds of Rhodiola, Rosarin contributes to its adaptogenic and neuroprotective properties. Research indicates that Rosarin supports stress adaptation, cognitive function, and fatigue reduction, partly through modulation of the hypothalamic–pituitary–adrenal (HPA) axis and neurotransmitter balance. It also exhibits antioxidant and anti-inflammatory activities, providing additional value in metabolic and neurological studies. Rosarin serves as a key reference standard for phytochemical analysis, natural product pharmacology, and botanical-based therapeutic development.
| CAS Number | 84954-93-8 |
| Synonyms | (2R,3S,4S,5R,6R)-2-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxymethyl]-6-[(E)-3-phenylprop-2-enoxy]oxane-3,4,5-triol |
| Molecular Formula | C20H28O10 |
| Purity | ≥95% |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxymethyl]-6-[(E)-3-phenylprop-2-enoxy]oxane-3,4,5-triol |
| InChI | InChI=1S/C20H28O10/c21-9-12-14(22)17(25)20(29-12)28-10-13-15(23)16(24)18(26)19(30-13)27-8-4-7-11-5-2-1-3-6-11/h1-7,12-26H,8-10H2/b7-4+/t12-,13+,14-,15+,16-,17+,18+,19+,20+/m0/s1 |
| InChIKey | IEBFEMIXXHIISM-YZOUKVLTSA-N |
| SMILES | C1=CC=C(C=C1)C=CCOC2C(C(C(C(O2)COC3C(C(C(O3)CO)O)O)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
