For research use only. Not for therapeutic Use.
RORγt Inverse Agonist 6（Cat No.:I046070）is a synthetic small molecule targeting the nuclear receptor RORγt, a transcription factor central to Th17 cell differentiation and IL-17 cytokine production. By acting as an inverse agonist, it suppresses RORγt activity, thereby reducing IL-17-mediated inflammation. This compound is valuable in studying autoimmune disorders, including multiple sclerosis, rheumatoid arthritis, and psoriasis, where Th17 signaling plays a pathogenic role. Its selective modulation of immune pathways makes it a promising pharmacological tool for dissecting RORγt-driven mechanisms in disease research.
| CAS Number | 1887161-80-9 |
| Synonyms | (2R)-2-N-(3-chloro-4-cyanophenyl)-4-N-[3-(cyclopropylmethyl)-2,4-dioxo-1-propan-2-ylquinazolin-6-yl]morpholine-2,4-dicarboxamide |
| Molecular Formula | C28H29ClN6O5 |
| Purity | ≥95% |
| IUPAC Name | (2R)-2-N-(3-chloro-4-cyanophenyl)-4-N-[3-(cyclopropylmethyl)-2,4-dioxo-1-propan-2-ylquinazolin-6-yl]morpholine-2,4-dicarboxamide |
| InChI | InChI=1S/C28H29ClN6O5/c1-16(2)35-23-8-7-19(11-21(23)26(37)34(28(35)39)14-17-3-4-17)32-27(38)33-9-10-40-24(15-33)25(36)31-20-6-5-18(13-30)22(29)12-20/h5-8,11-12,16-17,24H,3-4,9-10,14-15H2,1-2H3,(H,31,36)(H,32,38)/t24-/m1/s1 |
| InChIKey | QUTSLTZISBFEOJ-XMMPIXPASA-N |
| SMILES | CC(C)N1C2=C(C=C(C=C2)NC(=O)N3CCO[C@H](C3)C(=O)NC4=CC(=C(C=C4)C#N)Cl)C(=O)N(C1=O)CC5CC5 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
