For research use only. Not for therapeutic Use.
Roquinimex (Cat No.:I005036) is an immunomodulator that inhibits the secretion of TNF-α. It enhances natural killer (NK) cell activity and T lymphocyte-mediated effector functions, making it a novel immunomodulatory drug. Additionally, Roquinimex demonstrates potential as an orally active anti-angiogenic agent, indicating its effectiveness in inhibiting blood vessel formation. These properties suggest that Roquinimex holds promise as an anti-tumor therapy.
| Catalog Number | I005036 |
| CAS Number | 84088-42-6 |
| Molecular Formula | C18H16N2O3 |
| Purity | ≥95% |
| Target | TNF Receptor |
| Solubility | 10 mM in DMSO |
| Storage | 2-8°C |
| IUPAC Name | 4-hydroxy-N,1-dimethyl-2-oxo-N-phenylquinoline-3-carboxamide |
| InChI | InChI=1S/C18H16N2O3/c1-19(12-8-4-3-5-9-12)17(22)15-16(21)13-10-6-7-11-14(13)20(2)18(15)23/h3-11,21H,1-2H3 |
| InChIKey | SGOOQMRIPALTEL-UHFFFAOYSA-N |
| SMILES | CN1C2=CC=CC=C2C(=C(C1=O)C(=O)N(C)C3=CC=CC=C3)O |
