For research use only. Not for therapeutic Use.
Roflumilast related substances (Cat No.: M141539) are chemical impurities, intermediates, or degradation products structurally similar to roflumilast, a selective phosphodiesterase-4 (PDE4) inhibitor used in the treatment of chronic obstructive pulmonary disease (COPD). These related compounds may arise during synthesis, storage, or metabolic processes. Monitoring and controlling them is essential for ensuring drug purity, safety, and regulatory compliance. Analytical techniques such as HPLC, LC-MS, and NMR are commonly employed to identify and quantify these substances during pharmaceutical development and quality control of roflumilast formulations.
| CAS Number | 1243391-44-7 |
| Molecular Formula | C11H12O4 |
| Purity | ≥95% |
| Storage | Store at +4℃ |
| IUPAC Name | 3-(cyclopropylmethoxy)-4-hydroxybenzoic acid |
| InChI | InChI=1S/C11H12O4/c12-9-4-3-8(11(13)14)5-10(9)15-6-7-1-2-7/h3-5,7,12H,1-2,6H2,(H,13,14) |
| InChIKey | CPGNRCZMIIWDPZ-UHFFFAOYSA-N |
| SMILES | C1CC1COC2=C(C=CC(=C2)C(=O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
