For research use only. Not for therapeutic Use.
Roemerine（Cat No.:I015359）is an aporphine alkaloid isolated from plants such as Annona and Magnolia species, known for its diverse pharmacological activities. It exhibits antimicrobial, anti-inflammatory, vasorelaxant, and potential anticancer effects. Mechanistically, roemerine interacts with multiple molecular targets, including ion channels and receptors, influencing smooth muscle relaxation and neurotransmission. In cancer studies, it has shown the ability to induce apoptosis and inhibit tumor cell proliferation. Its broad bioactivity profile makes roemerine a valuable natural compound for drug discovery, offering insights into therapeutic development across infectious, cardiovascular, and oncological research fields.
| CAS Number | 548-08-3 |
| Synonyms | (12R)-11-methyl-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,14,16,18-hexaene |
| Molecular Formula | C18H17NO2 |
| Purity | ≥95% |
| IUPAC Name | (12R)-11-methyl-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,14,16,18-hexaene |
| InChI | InChI=1S/C18H17NO2/c1-19-7-6-12-9-15-18(21-10-20-15)17-13-5-3-2-4-11(13)8-14(19)16(12)17/h2-5,9,14H,6-8,10H2,1H3/t14-/m1/s1 |
| InChIKey | JCTYWRARKVGOBK-CQSZACIVSA-N |
| SMILES | CN1CCC2=CC3=C(C4=C2[C@H]1CC5=CC=CC=C54)OCO3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
