For research use only. Not for therapeutic Use.
RO5203648（Cat No.:I009159）is a selective inhibitor of the protein kinase Mnk1/2 (mitogen-activated protein kinase interacting kinases), which play a key role in the regulation of protein synthesis and cellular stress responses. By inhibiting Mnk1/2, RO5203648 can reduce the phosphorylation of eIF4E, a critical factor in the translation of specific mRNAs involved in cell growth, survival, and cancer progression. This compound is being explored for its potential therapeutic application in cancer, particularly in targeting tumors with aberrant Mnk signaling, offering a new approach to modulate protein synthesis in malignancies.
| CAS Number | 1043491-54-8 |
| Synonyms | (4S)-4-(3,4-dichlorophenyl)-4,5-dihydro-1,3-oxazol-2-amine |
| Molecular Formula | C9H8Cl2N2O |
| Purity | ≥95% |
| IUPAC Name | (4S)-4-(3,4-dichlorophenyl)-4,5-dihydro-1,3-oxazol-2-amine |
| InChI | InChI=1S/C9H8Cl2N2O/c10-6-2-1-5(3-7(6)11)8-4-14-9(12)13-8/h1-3,8H,4H2,(H2,12,13)/t8-/m1/s1 |
| InChIKey | HGGPGNSCBBAGJN-MRVPVSSYSA-N |
| SMILES | C1[C@@H](N=C(O1)N)C2=CC(=C(C=C2)Cl)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
