For research use only. Not for therapeutic Use.
RO495（Cat No.:M142841）is a selective inhibitor of the protein kinase AKT, which plays a crucial role in regulating cell growth, survival, and metabolism. AKT signaling is often dysregulated in cancer, contributing to tumor growth, metastasis, and resistance to therapy. By inhibiting AKT, RO495 disrupts these critical processes, potentially slowing down cancer progression and improving the response to other treatments. This compound is being investigated for its therapeutic potential in various cancers, offering a targeted approach to modulate AKT-driven signaling pathways, with the goal of enhancing the effectiveness of cancer therapies.
| CAS Number | 1258296-60-4 |
| Synonyms | N-[2-[(2-amino-6-methylpyrimidin-4-yl)amino]pyridin-4-yl]-2,6-dichlorobenzamide |
| Molecular Formula | C17H14Cl2N6O |
| Purity | ≥95% |
| IUPAC Name | N-[2-[(2-amino-6-methylpyrimidin-4-yl)amino]pyridin-4-yl]-2,6-dichlorobenzamide |
| InChI | InChI=1S/C17H14Cl2N6O/c1-9-7-14(25-17(20)22-9)24-13-8-10(5-6-21-13)23-16(26)15-11(18)3-2-4-12(15)19/h2-8H,1H3,(H4,20,21,22,23,24,25,26) |
| InChIKey | LNGDQKGREFSTHB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)N)NC2=NC=CC(=C2)NC(=O)C3=C(C=CC=C3Cl)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
