For research use only. Not for therapeutic Use.
Ro 41-0960（Cat No.:I044115）is a potent and selective inhibitor of catechol-O-methyltransferase (COMT), an enzyme involved in the degradation of catecholamines such as dopamine, epinephrine, and norepinephrine. By inhibiting COMT, Ro 41-0960 prolongs the action of these neurotransmitters, making it a valuable research tool in neuropharmacology and neurodegenerative disease studies, especially Parkinson’s disease. Unlike some COMT inhibitors, Ro 41-0960 is a hydrophilic compound with limited blood-brain barrier penetration, allowing selective investigation of peripheral COMT activity. It supports research into dopaminergic signaling, drug interactions, and the development of COMT-targeted therapies.
| CAS Number | 125628-97-9 |
| Synonyms | (3,4-dihydroxy-5-nitrophenyl)-(2-fluorophenyl)methanone |
| Molecular Formula | C13H8FNO5 |
| Purity | ≥95% |
| IUPAC Name | (3,4-dihydroxy-5-nitrophenyl)-(2-fluorophenyl)methanone |
| InChI | InChI=1S/C13H8FNO5/c14-9-4-2-1-3-8(9)12(17)7-5-10(15(19)20)13(18)11(16)6-7/h1-6,16,18H |
| InChIKey | RQPAUNZYTYHKHA-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C2=CC(=C(C(=C2)O)O)[N+](=O)[O-])F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
