For research use only. Not for therapeutic Use.
Ro 3-1314（Cat No.:I011560）is a synthetic monoamine oxidase B (MAO-B) inhibitor known for its role in neurological research, particularly in the study and potential treatment of Parkinson’s disease. By selectively inhibiting MAO-B, Ro 3-1314 reduces the breakdown of dopamine in the brain, thereby enhancing dopaminergic signaling and mitigating motor symptoms associated with neurodegeneration. It also helps limit oxidative stress caused by dopamine metabolism. Ro 3-1314 is used experimentally to explore the therapeutic potential of MAO-B inhibitors and to better understand the pathophysiology of neurodegenerative disorders involving dopaminergic dysfunction.
| CAS Number | 2012-14-8 |
| Synonyms | octadeca-9,12-diynoic acid |
| Molecular Formula | C18H28O2 |
| Purity | ≥95% |
| IUPAC Name | octadeca-9,12-diynoic acid |
| InChI | InChI=1S/C18H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2-5,8,11-17H2,1H3,(H,19,20) |
| InChIKey | KDYILQLPKVZDGB-UHFFFAOYSA-N |
| SMILES | CCCCCC#CCC#CCCCCCCCC(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
