For research use only. Not for therapeutic Use.
Ritonavir-d6(Cat No.:S000410) is a deuterated version of ritonavir, where six hydrogen atoms are replaced with deuterium, enhancing its metabolic stability for research purposes. Ritonavir is a protease inhibitor used primarily to treat HIV/AIDS. It functions by inhibiting the HIV protease enzyme, crucial for the virus’s replication. Besides its use as an antiretroviral, ritonavir is also commonly employed to boost the effectiveness of other HIV medications by slowing their metabolism. The deuterated version, Ritonavir-d6, allows for more precise pharmacokinetic studies, providing insights into the drug’s behavior and interactions within the body.
| CAS Number | 1616968-73-0 |
| Molecular Formula | C37H42D6N6O5S2 |
| Purity | ≥95% |
| Target | Metabolic Enzyme/Protease |
| IUPAC Name | 1,3-thiazol-5-ylmethyl N-[(2S,3S,5S)-5-[[(2S)-2-[[[2-(1,1,1,3,3,3-hexadeuteriopropan-2-yl)-1,3-thiazol-4-yl]methyl-methylcarbamoyl]amino]-3-methylbutanoyl]amino]-3-hydroxy-1,6-diphenylhexan-2-yl]carbamate |
| InChI | InChI=1S/C37H48N6O5S2/c1-24(2)33(42-36(46)43(5)20-29-22-49-35(40-29)25(3)4)34(45)39-28(16-26-12-8-6-9-13-26)18-32(44)31(17-27-14-10-7-11-15-27)41-37(47)48-21-30-19-38-23-50-30/h6-15,19,22-25,28,31-33,44H,16-18,20-21H2,1-5H3,(H,39,45)(H,41,47)(H,42,46)/t28-,31-,32-,33-/m0/s1/i3D3,4D3 |
| InChIKey | NCDNCNXCDXHOMX-GMBJSHJASA-N |
| SMILES | CC(C)C1=NC(=CS1)CN(C)C(=O)NC(C(C)C)C(=O)NC(CC2=CC=CC=C2)CC(C(CC3=CC=CC=C3)NC(=O)OCC4=CN=CS4)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |