For research use only. Not for therapeutic Use.
Rifamycin is a class of antibiotics known for their broad-spectrum activity against bacteria. They work by inhibiting bacterial RNA synthesis, which is essential for the bacteria’s survival and replication. Rifamycins are commonly used to treat bacterial infections such as tuberculosis, legionellosis, and certain types of meningitis. They are also used in combination with other antibiotics to treat infections caused by multidrug-resistant bacteria. Rifamycins are available in various forms, including oral and injectable formulations. While generally well-tolerated, they can cause side effects such as gastrointestinal upset and liver toxicity, requiring careful monitoring during treatment.
CAS Number | 6998-60-3 |
Synonyms | Rifamycin SV |
Molecular Formula | C37H47NO12 |
Purity | 98% |
Target | rpoB rpoA rpoC |
Target Protein | P0A8V2,P0A7Z4,P0A8T7 |
Appearance | Solid |
IUPAC Name | [(7S,9E,11S,12R,13S,14R,15R,16R,17S,18S,19E,21Z)-2,15,17,27,29-pentahydroxy-11-methoxy-3,7,12,14,16,18,22-heptamethyl-6,23-dioxo-8,30-dioxa-24-azatetracyclo[23.3.1.14,7.05,28]triaconta-1(29),2,4,9,19,21,25,27-octaen-13-yl] acetate |
InChI | InChI=1S/C37H47NO12/c1-16-11-10-12-17(2)36(46)38-23-15-24(40)26-27(32(23)44)31(43)21(6)34-28(26)35(45)37(8,50-34)48-14-13-25(47-9)18(3)33(49-22(7)39)20(5)30(42)19(4)29(16)41/h10-16,18-20,25,29-30,33,40-44H,1-9H3,(H,38,46)/b11-10+,14-13+,17-12-/t16-,18+,19+,20+,25-,29-,30+,33+,37-/m0/s1 |
InChIKey | HJYYPODYNSCCOU-ODRIEIDWSA-N |
SMILES | CC1C=CC=C(C(=O)NC2=CC(=C3C(=C2O)C(=C(C4=C3C(=O)C(O4)(OC=CC(C(C(C(C(C(C1O)C)O)C)OC(=O)C)C)OC)C)C)O)O)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |