For research use only. Not for therapeutic Use.
Ricinoleic acid is a naturally occurring 12-<wbr></wbr>hydroxy fatty acid. It constitutes about 90% of the fatty acids in castor oil. Ricinoleic acid can serve as a substrate for the synthesis of conjugated linoleic acids. It is considered safe and non-<wbr></wbr>toxic as a food constituent in humans, up to a daily intake of 2.5 grams per day. In high doses, castor oil has a laxative effect.
| CAS Number | 141-22-0 |
| Synonyms | [R-(Z)]-12-Hydroxy-9-octadecenoic Acid; Ricinoleic Acid; (9Z,12R)-12-Hydroxyoctadec-9-enoic Acid; (R)-12-Hydroxyoleic Acid; 12-D-Hydroxy-9-cis-octadecenoic Acid; 12-Hydroxy-cis-9-octadecenoic Acid; 12-Hydroxyoctadeca-9-enoic Acid; CS 80; Cenwax C; Ed |
| Molecular Formula | C18H34O3 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (Z,12R)-12-hydroxyoctadec-9-enoic acid |
| InChI | InChI=1S/C18H34O3/c1-2-3-4-11-14-17(19)15-12-9-7-5-6-8-10-13-16-18(20)21/h9,12,17,19H,2-8,10-11,13-16H2,1H3,(H,20,21)/b12-9-/t17-/m1/s1 |
| InChIKey | WBHHMMIMDMUBKC-QJWNTBNXSA-N |
| SMILES | CCCCCCC(CC=CCCCCCCCC(=O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |