For research use only. Not for therapeutic Use.
Rhodiolin（Cat No.:I018391）is a bioactive flavonoid compound isolated from Rhodiola species, medicinal plants widely recognized for their adaptogenic properties. This natural product has been studied for its antioxidant, anti-inflammatory, neuroprotective, and cardioprotective effects. Research suggests Rhodiolin may help reduce oxidative stress, support cognitive function, and modulate immune responses, making it relevant in studies on neurodegeneration, fatigue, and metabolic disorders. As a purified reference standard, Rhodiolin is valuable in phytochemistry, pharmacology, and nutraceutical development, providing insights into the therapeutic potential of Rhodiola-derived flavonoids in modern biomedical and natural product research.
| CAS Number | 86831-53-0 |
| Synonyms | (2R,3R)-6,8-dihydroxy-3-(4-hydroxy-3-methoxyphenyl)-2-(hydroxymethyl)-9-(4-hydroxyphenyl)-2,3-dihydropyrano[3,2-h][1,4]benzodioxin-7-one |
| Molecular Formula | C25H20O10 |
| Purity | ≥95% |
| IUPAC Name | (2R,3R)-6,8-dihydroxy-3-(4-hydroxy-3-methoxyphenyl)-2-(hydroxymethyl)-9-(4-hydroxyphenyl)-2,3-dihydropyrano[3,2-h][1,4]benzodioxin-7-one |
| InChI | InChI=1S/C25H20O10/c1-32-16-8-12(4-7-14(16)28)22-18(10-26)34-24-17(33-22)9-15(29)19-20(30)21(31)23(35-25(19)24)11-2-5-13(27)6-3-11/h2-9,18,22,26-29,31H,10H2,1H3/t18-,22-/m1/s1 |
| InChIKey | POVCYOFRCMBMKD-XMSQKQJNSA-N |
| SMILES | COC1=C(C=CC(=C1)[C@@H]2[C@H](OC3=C(O2)C=C(C4=C3OC(=C(C4=O)O)C5=CC=C(C=C5)O)O)CO)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
