For research use only. Not for therapeutic Use.
Rhodamine B amine(Cat No.:M006686) is a derivative of Rhodamine B, a synthetic dye known for its intense pink to purple coloration. This derivative modifies the original dye structure by incorporating an amine group, enhancing its chemical reactivity and making it suitable for covalent binding to other molecules. Rhodamine B amine is particularly valuable in the field of fluorescence microscopy and labeling studies due to its bright fluorescence under light. It is used to tag biomolecules, aiding in the visualization and tracking of cellular and molecular processes in biological research.
CAS Number | 100992-88-9 |
Synonyms | XanthyliuM, 9-[4(or5)-aMino-2-carboxyphenyl]-3,6-bis(diethylaMino)-, inner salt |
Molecular Formula | C28H32ClN3O3 |
Purity | ≥95% |
Storage | -80°C |
IUPAC Name | [9-(4-amino-2-carboxyphenyl)-6-(diethylamino)xanthen-3-ylidene]-diethylazanium;chloride |
InChI | InChI=1S/C28H31N3O3.ClH/c1-5-30(6-2)19-10-13-22-25(16-19)34-26-17-20(31(7-3)8-4)11-14-23(26)27(22)21-12-9-18(29)15-24(21)28(32)33;/h9-17,29H,5-8H2,1-4H3,(H,32,33);1H |
InChIKey | KHPKXARDVYLOSQ-UHFFFAOYSA-N |
SMILES | CCN(CC)C1=CC2=C(C=C1)C(=C3C=CC(=[N+](CC)CC)C=C3O2)C4=C(C=C(C=C4)N)C(=O)O.[Cl-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |