For research use only. Not for therapeutic Use.
Rhein 8-Glucoside(CAT: R041534) is an anthraquinone glycoside isolated from medicinal plants such as Rheum (rhubarb) species. It exhibits anti-inflammatory, antioxidant, and hepatoprotective properties, and serves as a key metabolite of the aglycone rhein. The glucoside form improves solubility and modulates bioavailability, making it an important subject in pharmacokinetic and metabolism studies. Research shows that Rhein 8-Glucoside can regulate oxidative stress, suppress inflammatory mediators, and protect against toxin-induced organ damage. With relevance to liver disease, inflammation, and metabolic disorders, Rhein 8-Glucoside is a valuable compound for natural product pharmacology and therapeutic mechanism research.
| CAS Number | 34298-86-7 |
| Synonyms | 4-hydroxy-9,10-dioxo-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyanthracene-2-carboxylic acid |
| Molecular Formula | C21H18O11 |
| Purity | ≥95% |
| IUPAC Name | 4-hydroxy-9,10-dioxo-5-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyanthracene-2-carboxylic acid |
| InChI | InChI=1S/C21H18O11/c22-6-12-16(25)18(27)19(28)21(32-12)31-11-3-1-2-8-14(11)17(26)13-9(15(8)24)4-7(20(29)30)5-10(13)23/h1-5,12,16,18-19,21-23,25,27-28H,6H2,(H,29,30)/t12-,16-,18+,19-,21-/m1/s1 |
| InChIKey | WYKUTTFFZMQCGO-HTRBZNBPSA-N |
| SMILES | C1=CC2=C(C(=C1)OC3C(C(C(C(O3)CO)O)O)O)C(=O)C4=C(C2=O)C=C(C=C4O)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
