For research use only. Not for therapeutic Use.
Rhapontigenin 3′-O-glucoside(CAT: I017086) is a stilbene glucoside derivative naturally occurring in plants such as Rheum species. As a glycosylated form of rhapontigenin, it combines the antioxidant and anti-inflammatory properties of stilbenes with enhanced stability and solubility provided by the glucose moiety. Research suggests it may protect against oxidative stress, modulate inflammatory pathways, and support cardiovascular and metabolic health. Additionally, its structural similarity to resveratrol derivatives has led to interest in its potential anticancer and neuroprotective applications. With its unique stilbene-based profile, Rhapontigenin 3′-O-glucoside is a promising natural compound for biomedical research into chronic inflammatory, metabolic, and degenerative diseases.
| CAS Number | 94356-22-6 |
| Synonyms | (2S,3R,4S,5S,6R)-2-[5-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]-2-methoxyphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| Molecular Formula | C21H24O9 |
| Purity | ≥95% |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-[5-[(E)-2-(3,5-dihydroxyphenyl)ethenyl]-2-methoxyphenoxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| InChI | InChI=1S/C21H24O9/c1-28-15-5-4-11(2-3-12-6-13(23)9-14(24)7-12)8-16(15)29-21-20(27)19(26)18(25)17(10-22)30-21/h2-9,17-27H,10H2,1H3/b3-2+/t17-,18-,19+,20-,21-/m1/s1 |
| InChIKey | NMZBFHDKUAVGLR-DXKBKAGUSA-N |
| SMILES | COC1=C(C=C(C=C1)C=CC2=CC(=CC(=C2)O)O)OC3C(C(C(C(O3)CO)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
