For research use only. Not for therapeutic Use.
RH01386(CAT:I017144) is a small-molecule modulator that protects pancreatic β cells from endoplasmic reticulum stress (ERS)-induced dysfunction and apoptosis. It restores glucose-stimulated insulin secretion impaired by ERS and suppresses proapoptotic gene expression, highlighting its therapeutic potential in type 2 diabetes research. In βTC6 cells exposed to tunicamycin, RH01386 dose-dependently increased ATP production (EC₅₀ = 1.894 μM) and significantly reduced ERS-induced cell death. Additionally, it inhibited caspase-3 activity, a key effector in apoptosis. By improving β cell survival and metabolic function, RH01386 serves as a valuable tool for studying ERS pathways, β cell biology, and diabetes drug discovery.
| CAS Number | 301177-36-6 |
| Synonyms | 4-cyclohexyl-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
| Molecular Formula | C18H15F3N4O3S |
| Purity | ≥95% |
| IUPAC Name | 4-cyclohexyl-2-[2-nitro-4-(trifluoromethyl)phenyl]sulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
| InChI | InChI=1S/C18H15F3N4O3S/c19-18(20,21)11-6-7-14(13(8-11)25(27)28)29-17-23-15(10-4-2-1-3-5-10)12(9-22)16(26)24-17/h6-8,10H,1-5H2,(H,23,24,26) |
| InChIKey | BVWCKDMNROTYMZ-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C2=C(C(=O)NC(=N2)SC3=C(C=C(C=C3)C(F)(F)F)[N+](=O)[O-])C#N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
