For research use only. Not for therapeutic Use.
RGW-611（Cat No.:R030417）is a selective peptide inhibitor that targets specific protein interactions involved in various diseases, particularly in cancer research. It is designed to interfere with cellular pathways that contribute to tumor growth and metastasis. RGW-611 is being investigated for its potential in treating specific types of cancer by modulating the activity of key enzymes or receptors that play a role in disease progression. While promising in preclinical studies, further clinical research is needed to evaluate its safety, efficacy, and potential as a therapeutic agent for cancer and related conditions.
| CAS Number | 6497-78-5 |
| Synonyms | 4-[2-(4-nitroimidazol-1-yl)ethyl]morpholine |
| Molecular Formula | C9H14N4O3 |
| Purity | ≥95% |
| IUPAC Name | 4-[2-(4-nitroimidazol-1-yl)ethyl]morpholine |
| InChI | InChI=1S/C9H14N4O3/c14-13(15)9-7-12(8-10-9)2-1-11-3-5-16-6-4-11/h7-8H,1-6H2 |
| InChIKey | VDZAAIIQCHGJAD-UHFFFAOYSA-N |
| SMILES | C1COCCN1CCN2C=C(N=C2)[N+](=O)[O-] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
