For research use only. Not for therapeutic Use.
RGB-1(CAT: I040566) is a polycyclic aromatic hydrocarbon compound known for its ability to selectively stabilize RNA G-quadruplex structures. By binding to these secondary RNA configurations, RGB-1 promotes the inhibition of mRNA translation, particularly affecting oncogenic transcripts. In breast cancer cell models, RGB-1 has been shown to reduce the expression of the NRAS proto-oncogene, a key regulator in cell proliferation and survival. This makes RGB-1 a valuable tool for studying RNA structure-function relationships and exploring RNA-targeted therapeutic strategies. Its unique mechanism supports research into post-transcriptional regulation and the development of anti-cancer agents targeting G-quadruplex-mediated gene expression.
| CAS Number | 930455-91-7 |
| Synonyms | 8,18-bis(furan-2-yl)-6,16-dithia-1,4,11,14-tetrazapentacyclo[11.7.0.03,11.05,9.015,19]icosa-3,5(9),7,13,15(19),17-hexaene-10,20-dione |
| Molecular Formula | C22H12N4O4S2 |
| Purity | ≥95% |
| IUPAC Name | 8,18-bis(furan-2-yl)-6,16-dithia-1,4,11,14-tetrazapentacyclo[11.7.0.03,11.05,9.015,19]icosa-3,5(9),7,13,15(19),17-hexaene-10,20-dione |
| InChI | InChI=1S/C22H12N4O4S2/c27-21-17-11(13-3-1-5-29-13)9-31-19(17)23-15-8-26-16(7-25(15)21)24-20-18(22(26)28)12(10-32-20)14-4-2-6-30-14/h1-6,9-10H,7-8H2 |
| InChIKey | QNXKYGQXHUFVRZ-UHFFFAOYSA-N |
| SMILES | C1C2=NC3=C(C(=CS3)C4=CC=CO4)C(=O)N2CC5=NC6=C(C(=CS6)C7=CC=CO7)C(=O)N51 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
