For research use only. Not for therapeutic Use.
Retinol-d6(Cat No.:S000562) is a specialized form of retinol, a precursor to active forms of vitamin A crucial for vision, immune function, and cellular growth and differentiation. The “d6” designation indicates that six hydrogen atoms in the retinol molecule are replaced with deuterium, a stable isotope of hydrogen. This isotopic labeling enables precise tracking of retinol metabolism and its distribution in biological systems using advanced analytical techniques like mass spectrometry. Retinol-d6 serves as a valuable tool in pharmacokinetic studies, aiding in elucidating vitamin A metabolism, understanding its bioavailability, and investigating its role in various physiological processes and disease states.
CAS Number | 2483831-77-0 |
Molecular Formula | C20H24D6O |
Purity | ≥95% |
Target | Endogenous Metabolite |
IUPAC Name | (2E,4E,6E,8E)-3,7-bis(trideuteriomethyl)-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-ol |
InChI | InChI=1S/C20H30O/c1-16(8-6-9-17(2)13-15-21)11-12-19-18(3)10-7-14-20(19,4)5/h6,8-9,11-13,21H,7,10,14-15H2,1-5H3/b9-6+,12-11+,16-8+,17-13+/i1D3,2D3 |
InChIKey | FPIPGXGPPPQFEQ-ILKHKWFDSA-N |
SMILES | CC1=C(C(CCC1)(C)C)C=CC(=CC=CC(=CCO)C)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |