For research use only. Not for therapeutic Use.
Retinaloxime(Cat No.:M087834) is a chemical compound that interacts specifically with the retinal, a form of vitamin A crucial for vision. It functions by binding to the aldehyde group of retinal, potentially altering its activity or processing within the eye. This binding could influence the visual cycle, which is vital for converting light into electrical signals by the retina. Researchers are interested in retinal oxime because it might help modulate retinal diseases or disorders related to vitamin A metabolism. Its study is primarily in experimental stages, focusing on understanding its biochemical behavior and therapeutic potential.
| CAS Number | 17672-05-8 |
| Synonyms | retinaloxime |
| Molecular Formula | C20H29NO |
| Purity | ≥95% |
| Storage | Store at -20C |
| IUPAC Name | (NE)-N-[(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenylidene]hydroxylamine |
| InChI | InChI=1S/C20H29NO/c1-16(8-6-9-17(2)13-15-21-22)11-12-19-18(3)10-7-14-20(19,4)5/h6,8-9,11-13,15,22H,7,10,14H2,1-5H3/b9-6+,12-11+,16-8+,17-13+,21-15+ |
| InChIKey | UZIJYWXMEFEGMI-HUQYSEFFSA-N |
| SMILES | CC1=C(C(CCC1)(C)C)C=CC(=CC=CC(=CC=NO)C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |