Resorcinol(Cat No.:I000368)is a versatile organic compound widely used in various industrial applications, including the production of resins, plastics, and dyes. It serves as an essential intermediate in the synthesis of pharmaceuticals, particularly in dermatological preparations for treating acne, eczema, and psoriasis due to its antiseptic and exfoliating properties. Additionally, resorcinol is utilized in adhesive formulations, particularly for bonding rubber to metal in the tire industry. Its role in UV absorbers and flame retardants highlights its significance in enhancing material performance and safety across multiple sectors.
Catalog Number | I000368 |
CAS Number | 108-46-3 |
Molecular Formula | C6H6O2 |
Purity | ≥95% |
Solubility | 1000 mg/ml in H2O, 111 mg/ml in DMSO |
Storage | Store at -20°C |
IUPAC Name | benzene-1,3-diol |
InChI | InChI=1S/C6H6O2/c7-5-2-1-3-6(8)4-5/h1-4,7-8H |
InChIKey | GHMLBKRAJCXXBS-UHFFFAOYSA-N |
SMILES | C1=CC(=CC(=C1)O)O |