For research use only. Not for therapeutic Use.
Resolvin D4(Cat No.:R064551) is a high-purity specialized pro-resolving lipid mediator, essential for advanced pharmaceutical and biochemical research. This compound plays a crucial role in studying the resolution of inflammation, immune response modulation, and cellular signaling pathways. Its high stability and purity ensure precise and reliable analytical results, making it ideal for applications in inflammatory disease research, therapeutic efficacy studies, and drug development. The enhanced stability and consistency of Resolvin D4 make it suitable for various experimental setups, offering a robust and cost-effective solution for high-precision scientific investigations.
CAS Number | 1025684-60-9 |
Synonyms | RvD4 |
Molecular Formula | C22H32O5 |
Purity | ≥95% |
Target | Bacterial |
Storage | -80°C |
IUPAC Name | (4S,5R,6E,8E,10Z,13Z,15E,17S,19Z)-4,5,17-trihydroxydocosa-6,8,10,13,15,19-hexaenoic acid |
InChI | InChI=1S/C22H32O5/c1-2-3-11-14-19(23)15-12-9-7-5-4-6-8-10-13-16-20(24)21(25)17-18-22(26)27/h3-4,6-13,15-16,19-21,23-25H,2,5,14,17-18H2,1H3,(H,26,27)/b6-4-,9-7-,10-8+,11-3-,15-12+,16-13+/t19-,20+,21-/m0/s1 |
InChIKey | YKPLJNOOLKUEBS-RIYRYSNMSA-N |
SMILES | CC/C=C\C[C@@H](/C=C/C=C\C/C=C\C=C\C=C\[C@H]([C@H](CCC(=O)O)O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |