For research use only. Not for therapeutic Use.
rel-cis-Pinic acid(CAT: R043473) is a naturally occurring bicyclic dicarboxylic acid derived from the atmospheric oxidation of α-pinene, a major monoterpene emitted by coniferous trees. It exists as a specific stereoisomer within the pinic acid family, characterized by a cis-configuration across its ring junction. rel-cis-Pinic acid plays an important role in atmospheric chemistry as a key intermediate in secondary organic aerosol (SOA) formation. It is widely used in environmental and analytical studies to model biogenic oxidation products and their impact on air quality and climate. The compound also serves as a reference standard in mass spectrometry and photochemical oxidation experiments.
| CAS Number | 61774-58-1 |
| Synonyms | (1S,3S)-3-(carboxymethyl)-2,2-dimethylcyclobutane-1-carboxylic acid |
| Molecular Formula | C9H14O4 |
| Purity | ≥95% |
| IUPAC Name | (1S,3S)-3-(carboxymethyl)-2,2-dimethylcyclobutane-1-carboxylic acid |
| InChI | InChI=1S/C9H14O4/c1-9(2)5(4-7(10)11)3-6(9)8(12)13/h5-6H,3-4H2,1-2H3,(H,10,11)(H,12,13)/t5-,6+/m0/s1 |
| InChIKey | LEVONNIFUFSRKZ-NTSWFWBYSA-N |
| SMILES | CC1(C(CC1C(=O)O)CC(=O)O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
