For research use only. Not for therapeutic Use.
rel-Biotin-d4（Cat No.:R009250）is a stable isotope-labeled form of biotin, incorporating four deuterium atoms for enhanced tracking in analytical and biochemical studies. It retains the full biological activity of natural biotin, a vital coenzyme involved in carboxylation reactions and cellular metabolism. The “rel-” designation indicates a defined stereochemistry. rel-Biotin-d4 is commonly used in mass spectrometry, protein labeling, and metabolic flux experiments to quantify biotin-dependent pathways without interfering with native functions. Its deuterated structure enables precise differentiation from endogenous biotin, making it essential for pharmacokinetic and tracer-based research applications.
| CAS Number | 1217850-77-5 |
| Synonyms | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-3,3,4,4-tetradeuteriopentanoic acid |
| Molecular Formula | C10H12D4N2O3S |
| Purity | ≥95% |
| IUPAC Name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-3,3,4,4-tetradeuteriopentanoic acid |
| InChI | InChI=1S/C10H16N2O3S/c13-8(14)4-2-1-3-7-9-6(5-16-7)11-10(15)12-9/h6-7,9H,1-5H2,(H,13,14)(H2,11,12,15)/t6-,7-,9-/m0/s1/i1D2,2D2 |
| InChIKey | YBJHBAHKTGYVGT-CCSQOTJNSA-N |
| SMILES | [2H]C([2H])(C[C@H]1[C@@H]2[C@H](CS1)NC(=O)N2)C([2H])([2H])CC(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
