For research use only. Not for therapeutic Use.
RECQL5-IN-1（Cat No.:I044008）is a small molecule inhibitor targeting RECQL5, a helicase protein involved in DNA repair, replication, and maintaining genomic stability. RECQL5 plays a critical role in the regulation of DNA structures during replication and repair processes. By inhibiting RECQL5, RECQL5-IN-1 aims to disrupt DNA repair mechanisms, potentially sensitizing cancer cells to chemotherapy and radiation therapy. This compound is being studied for its potential to enhance the efficacy of existing cancer treatments, particularly in cancers with defects in DNA repair pathways, offering a novel approach to cancer therapy.
| CAS Number | 2718170-45-5 |
| Synonyms | 1-[(S)-(5-benzylsulfanyl-1,3,4-oxadiazol-2-yl)-phenylmethyl]-3-[3,5-bis(trifluoromethyl)phenyl]urea |
| Molecular Formula | C25H18F6N4O2S |
| Purity | ≥95% |
| IUPAC Name | 1-[(S)-(5-benzylsulfanyl-1,3,4-oxadiazol-2-yl)-phenylmethyl]-3-[3,5-bis(trifluoromethyl)phenyl]urea |
| InChI | InChI=1S/C25H18F6N4O2S/c26-24(27,28)17-11-18(25(29,30)31)13-19(12-17)32-22(36)33-20(16-9-5-2-6-10-16)21-34-35-23(37-21)38-14-15-7-3-1-4-8-15/h1-13,20H,14H2,(H2,32,33,36)/t20-/m0/s1 |
| InChIKey | BHTXRKYKSWDTRG-FQEVSTJZSA-N |
| SMILES | C1=CC=C(C=C1)CSC2=NN=C(O2)[C@H](C3=CC=CC=C3)NC(=O)NC4=CC(=CC(=C4)C(F)(F)F)C(F)(F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
