For research use only. Not for therapeutic Use.
RdRP-IN-2（Cat No.:I044401）is a selective small-molecule inhibitor targeting RNA-dependent RNA polymerase (RdRP), a crucial enzyme for viral RNA replication in RNA viruses. By inhibiting RdRP, RdRP-IN-2 disrupts the viral replication cycle, making it a promising candidate for antiviral therapy. This compound has shown potential activity against a range of RNA viruses, including coronaviruses and flaviviruses. RdRP-IN-2 is valuable for both therapeutic development and virology research, offering a targeted approach to interfere with viral genome synthesis and reduce viral load without affecting host cellular processes.
| CAS Number | 2863657-16-1 |
| Synonyms | (2S)-2-[(8-cyclohexyloxy-1-oxo-2-phenylpyrido[2,1-b][1,3]benzothiazole-4-carbonyl)amino]-3-phenylpropanoic acid |
| Molecular Formula | C33H30N2O5S |
| Purity | ≥95% |
| IUPAC Name | (2S)-2-[(8-cyclohexyloxy-1-oxo-2-phenylpyrido[2,1-b][1,3]benzothiazole-4-carbonyl)amino]-3-phenylpropanoic acid |
| InChI | InChI=1S/C33H30N2O5S/c36-30(34-27(33(38)39)18-21-10-4-1-5-11-21)26-20-25(22-12-6-2-7-13-22)31(37)35-28-19-24(16-17-29(28)41-32(26)35)40-23-14-8-3-9-15-23/h1-2,4-7,10-13,16-17,19-20,23,27H,3,8-9,14-15,18H2,(H,34,36)(H,38,39)/t27-/m0/s1 |
| InChIKey | BQZJTBOLNKPLGS-MHZLTWQESA-N |
| SMILES | C1CCC(CC1)OC2=CC3=C(C=C2)SC4=C(C=C(C(=O)N34)C5=CC=CC=C5)C(=O)N[C@@H](CC6=CC=CC=C6)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
