For research use only. Not for therapeutic Use.
RBN012759（Cat No.:I035461）is a potent and selective inhibitor of PRMT5 (protein arginine methyltransferase 5), an epigenetic regulator involved in symmetric dimethylation of arginine residues on histones and other proteins. PRMT5 plays a key role in gene expression, RNA splicing, and cell proliferation, and is frequently overexpressed in various cancers. By inhibiting PRMT5, RBN012759 disrupts tumor-promoting epigenetic modifications, leading to growth inhibition and apoptosis in cancer cells, particularly those with MTAP deletions. RBN012759 is under preclinical and clinical investigation as a targeted cancer therapy, offering a promising approach in precision oncology.
| CAS Number | 2360851-29-0 |
| Synonyms | 7-(cyclopropylmethoxy)-5-fluoro-2-[(4-hydroxycyclohexyl)sulfanylmethyl]-3H-quinazolin-4-one |
| Molecular Formula | C19H23FN2O3S |
| Purity | ≥95% |
| IUPAC Name | 7-(cyclopropylmethoxy)-5-fluoro-2-[(4-hydroxycyclohexyl)sulfanylmethyl]-3H-quinazolin-4-one |
| InChI | InChI=1S/C19H23FN2O3S/c20-15-7-13(25-9-11-1-2-11)8-16-18(15)19(24)22-17(21-16)10-26-14-5-3-12(23)4-6-14/h7-8,11-12,14,23H,1-6,9-10H2,(H,21,22,24) |
| InChIKey | NKZDEFKPZSLQRF-UHFFFAOYSA-N |
| SMILES | C1CC1COC2=CC3=C(C(=C2)F)C(=O)NC(=N3)CSC4CCC(CC4)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
