For research use only. Not for therapeutic Use.
RBC10（Cat No.:I012273）is a potent and selective inhibitor of the protein kinase Aurora B, which plays a crucial role in the regulation of cell division, specifically during mitosis. Aurora B ensures proper chromosome alignment and segregation, and its dysregulation can lead to aneuploidy and cancer. By inhibiting Aurora B, RBC10 disrupts mitotic processes, potentially leading to the selective killing of cancer cells, making it a promising candidate for cancer therapy. This compound is being studied for its ability to target rapidly dividing cancer cells while minimizing effects on normal cells, offering a targeted therapeutic approach.
| CAS Number | 362503-73-9 |
| Synonyms | 6-(2-chlorophenyl)-5-pentanoyl-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one |
| Molecular Formula | C24H25ClN2O2 |
| Purity | ≥95% |
| IUPAC Name | 6-(2-chlorophenyl)-5-pentanoyl-8,9,10,11-tetrahydro-6H-benzo[b][1,4]benzodiazepin-7-one |
| InChI | InChI=1S/C24H25ClN2O2/c1-2-3-15-22(29)27-20-13-7-6-11-18(20)26-19-12-8-14-21(28)23(19)24(27)16-9-4-5-10-17(16)25/h4-7,9-11,13,24,26H,2-3,8,12,14-15H2,1H3 |
| InChIKey | XERBEDAMDXRGFD-UHFFFAOYSA-N |
| SMILES | CCCCC(=O)N1C(C2=C(CCCC2=O)NC3=CC=CC=C31)C4=CC=CC=C4Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
