For research use only. Not for therapeutic Use.
RB-3（Cat No.:I044391）is a naturally occurring saponin compound, classified as a ginsenoside, predominantly found in Panax notoginseng and other ginseng species. It exhibits notable pharmacological activities, including antioxidant, anti-inflammatory, and neuroprotective effects. RB-3 has been studied for its ability to modulate key signaling pathways involved in oxidative stress and neuronal survival, making it a promising candidate for research in neurodegenerative diseases and cardiovascular disorders. Its bioactive profile also supports potential roles in improving cognitive function and reducing ischemic damage, positioning RB-3 as a valuable compound in traditional and modern therapeutic research.
| CAS Number | 2396639-11-3 |
| Synonyms | 3-(5-chloro-1H-indol-4-yl)-5-(1H-indol-4-yl)-4-propan-2-yl-1H-pyrrole-2-carboxylic acid |
| Molecular Formula | C24H20ClN3O2 |
| Purity | ≥95% |
| IUPAC Name | 3-(5-chloro-1H-indol-4-yl)-5-(1H-indol-4-yl)-4-propan-2-yl-1H-pyrrole-2-carboxylic acid |
| InChI | InChI=1S/C24H20ClN3O2/c1-12(2)19-21(20-15-9-11-27-18(15)7-6-16(20)25)23(24(29)30)28-22(19)14-4-3-5-17-13(14)8-10-26-17/h3-12,26-28H,1-2H3,(H,29,30) |
| InChIKey | IUEFQUANJWCUNT-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(NC(=C1C2=C(C=CC3=C2C=CN3)Cl)C(=O)O)C4=C5C=CNC5=CC=C4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
