For research use only. Not for therapeutic Use.
Rapanone（Cat No.:I044816）is a naturally occurring benzoquinone compound found in several plant species, including Ardisia and Primula. Structurally related to embelin, it features a 1,4-benzoquinone core with long alkyl side chains that enhance its lipophilicity and membrane permeability. Rapanone exhibits notable biological activities, including anti-inflammatory, antimicrobial, and especially anticancer effects, through mechanisms such as mitochondrial disruption and apoptosis induction. Its ability to interfere with cellular redox balance and inhibit tumor cell proliferation makes it a promising lead compound for anticancer drug development and a subject of interest in natural product research.
| CAS Number | 573-40-0 |
| Synonyms | 2,5-dihydroxy-3-tridecylcyclohexa-2,5-diene-1,4-dione |
| Molecular Formula | C19H30O4 |
| Purity | ≥95% |
| IUPAC Name | 2,5-dihydroxy-3-tridecylcyclohexa-2,5-diene-1,4-dione |
| InChI | InChI=1S/C19H30O4/c1-2-3-4-5-6-7-8-9-10-11-12-13-15-18(22)16(20)14-17(21)19(15)23/h14,20,23H,2-13H2,1H3 |
| InChIKey | AMKNOBHCKRZHIO-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCCCCCC1=C(C(=O)C=C(C1=O)O)O |
| Reference |
|
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
