For research use only. Not for therapeutic Use.
Randialic acid B（Cat No.:I044829）is a bioactive triterpenoid compound isolated from Randia species, plants traditionally used in ethnomedicine. Structurally, it features a pentacyclic triterpene framework with unique functional groups that contribute to its pharmacological potential. Randialic acid B has demonstrated notable anti-inflammatory and cytotoxic activities, likely through modulation of inflammatory mediators and induction of apoptosis in cancer cells. Its presence in medicinal plants underscores its potential as a lead compound for drug development. Ongoing research explores its mechanisms of action and therapeutic applications, particularly in inflammation-related and neoplastic diseases.
| CAS Number | 14021-14-8 |
| Synonyms | (2R,4aS,6aR,6aS,6bR,8aR,10S,12aR)-10-hydroxy-1,2,6a,6b,9,9,12a-heptamethyl-3,4,5,6,6a,7,8,8a,10,11,12,13-dodecahydro-2H-picene-4a-carboxylic acid |
| Molecular Formula | C30H46O3 |
| Purity | ≥95% |
| IUPAC Name | (2R,4aS,6aR,6aS,6bR,8aR,10S,12aR)-10-hydroxy-1,2,6a,6b,9,9,12a-heptamethyl-3,4,5,6,6a,7,8,8a,10,11,12,13-dodecahydro-2H-picene-4a-carboxylic acid |
| InChI | InChI=1S/C30H46O3/c1-18-10-15-30(25(32)33)17-16-28(6)20(24(30)19(18)2)8-9-22-27(5)13-12-23(31)26(3,4)21(27)11-14-29(22,28)7/h8,18,21-23,31H,9-17H2,1-7H3,(H,32,33)/t18-,21+,22-,23+,27+,28-,29-,30+/m1/s1 |
| InChIKey | GPQBTLJRTQXVOM-UORVSENQSA-N |
| SMILES | C[C@@H]1CC[C@@]2(CC[C@@]3(C(=CC[C@H]4[C@]3(CC[C@@H]5[C@@]4(CC[C@@H](C5(C)C)O)C)C)C2=C1C)C)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
