For research use only. Not for therapeutic Use.
rac-Terpenylic acid is a racemic mixture of terpenylic acid, which is a naturally occurring organic compound derived from terpenes. It features prominently in atmospheric chemistry as a marker for biogenic emissions from plants. This compound plays a crucial role in the formation of secondary organic aerosols, influencing air quality and climate.
| CAS Number | 116-51-8 |
| Synonyms | Tetrahydro-2,2-dimethyl-5-oxo-3-furanacetic Acid; 3-(1-Hydroxy-1-methylethyl)-γ-lactone Glutaric Acid; |
| Molecular Formula | C8H12O4 |
| Purity | ≥95% |
| Storage | +4 ℃ |
| IUPAC Name | 2-(2,2-dimethyl-5-oxooxolan-3-yl)acetic acid |
| InChI | InChI=1S/C8H12O4/c1-8(2)5(3-6(9)10)4-7(11)12-8/h5H,3-4H2,1-2H3,(H,9,10) |
| InChIKey | NQWMPKJASNNZMJ-UHFFFAOYSA-N |
| SMILES | CC1(C(CC(=O)O1)CC(=O)O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |