For research use only. Not for therapeutic Use.
(Rac)-SHIN2（Cat No.:I042658）is a small molecule inhibitor designed to target and inhibit the activity of the protein kinase Rac1, which plays a critical role in regulating cell signaling pathways involved in cell migration, proliferation, and survival. Dysregulation of Rac1 has been implicated in various diseases, including cancer, neurodegenerative disorders, and autoimmune diseases. By inhibiting Rac1, (Rac)-SHIN2 aims to prevent tumor metastasis, reduce inflammation, and modulate other pathological processes. Currently, it is being explored in preclinical studies for its potential therapeutic applications in cancer and other Rac1-driven conditions.
| CAS Number | 2204289-53-0 |
| Synonyms | 6-amino-4-[3-(hydroxymethyl)-5-(5-hydroxypent-1-ynyl)phenyl]-3-methyl-4-propan-2-yl-2H-pyrano[2,3-c]pyrazole-5-carbonitrile |
| Molecular Formula | C23H26N4O3 |
| Purity | ≥95% |
| IUPAC Name | 6-amino-4-[3-(hydroxymethyl)-5-(5-hydroxypent-1-ynyl)phenyl]-3-methyl-4-propan-2-yl-2H-pyrano[2,3-c]pyrazole-5-carbonitrile |
| InChI | InChI=1S/C23H26N4O3/c1-14(2)23(19(12-24)21(25)30-22-20(23)15(3)26-27-22)18-10-16(7-5-4-6-8-28)9-17(11-18)13-29/h9-11,14,28-29H,4,6,8,13,25H2,1-3H3,(H,26,27) |
| InChIKey | IWUCUJZMKDHLOF-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=NN1)OC(=C(C2(C3=CC(=CC(=C3)C#CCCCO)CO)C(C)C)C#N)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
