For research use only. Not for therapeutic Use.
(Rac)-RP-6306(Cat No.:I043978)is a selective, small-molecule inhibitor of the Aryl hydrocarbon receptor (AhR), an important regulator in immune response, xenobiotic metabolism, and tumor progression. The (Rac)-isomer of RP-6306 is specifically designed for enhanced potency and selectivity in inhibiting AhR, which plays a crucial role in various diseases, including cancer, inflammatory conditions, and autoimmune disorders. By blocking AhR activation, (Rac)-RP-6306 aims to reduce inflammation, alter immune cell activity, and inhibit tumor growth. This compound is being investigated for its therapeutic potential in treating cancers and inflammatory diseases where AhR is dysregulated.
CAS Number | 2719749-28-5 |
Synonyms | 2-amino-1-(3-hydroxy-2,6-dimethylphenyl)-5,6-dimethylpyrrolo[2,3-b]pyridine-3-carboxamide |
Molecular Formula | C18H20N4O2 |
Purity | ≥95% |
IUPAC Name | 2-amino-1-(3-hydroxy-2,6-dimethylphenyl)-5,6-dimethylpyrrolo[2,3-b]pyridine-3-carboxamide |
InChI | InChI=1S/C18H20N4O2/c1-8-5-6-13(23)10(3)15(8)22-16(19)14(17(20)24)12-7-9(2)11(4)21-18(12)22/h5-7,23H,19H2,1-4H3,(H2,20,24) |
InChIKey | ARBRHWRTXPWZGN-UHFFFAOYSA-N |
SMILES | CC1=C(C(=C(C=C1)O)C)N2C(=C(C3=C2N=C(C(=C3)C)C)C(=O)N)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |