For research use only. Not for therapeutic Use.
rac N-Desmethyl Venlafaxine-d3(Cat No.:R007788)is a high-purity, deuterated compound essential for advanced pharmaceutical research. This isotopically labeled version of N-Desmethyl Venlafaxine, featuring three deuterium atoms, is crucial for studies on drug metabolism, pharmacokinetics, and NMR spectroscopy. The stable isotope labeling ensures precise and reliable analytical results, enhancing the accuracy of experimental data. Ideal for various research applications, rac N-Desmethyl Venlafaxine-d3 integrates seamlessly into existing protocols, offering a robust and cost-effective solution for high-precision scientific investigations and the development of innovative therapeutic agents.
CAS Number | 1189980-40-2 |
Synonyms | 1-[1-(4-Methoxyphenyl)-2-(methyl-d3-amino)ethyl]cyclohexanol; Norvenlafaxine-d3; |
Molecular Formula | C16H25NO2 |
Purity | ≥95% |
Storage | -80°C |
IUPAC Name | 1-[1-(4-methoxyphenyl)-2-(trideuteriomethylamino)ethyl]cyclohexan-1-ol |
InChI | InChI=1S/C16H25NO2/c1-17-12-15(16(18)10-4-3-5-11-16)13-6-8-14(19-2)9-7-13/h6-9,15,17-18H,3-5,10-12H2,1-2H3/i1D3 |
InChIKey | MKAFOJAJJMUXLW-FIBGUPNXSA-N |
SMILES | [2H]C([2H])([2H])NCC(C1=CC=C(C=C1)OC)C2(CCCCC2)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |