For research use only. Not for therapeutic Use.
(Rac)-LY-3381916 (CAT: I017486) is the racemic mixture of LY-3381916, a potent, selective, and brain-penetrant indoleamine 2,3-dioxygenase 1 (IDO1) inhibitor. Unlike many IDO1 inhibitors that target the heme-bound enzyme, LY-3381916 preferentially binds to apo-IDO1 (heme-free form), providing a unique mechanism of action. This distinguishes it as a valuable chemical probe for studying the regulation of tryptophan metabolism and the kynurenine pathway, which are central to immune tolerance, cancer immunology, and neuroinflammatory processes. As a racemate, (Rac)-LY-3381916 enables comparative pharmacological studies with its enantiomers, supporting research into IDO1-targeted therapeutic strategies.
| CAS Number | 2166616-74-4 |
| Synonyms | 4-fluoro-N-[1-[1-(oxane-4-carbonyl)-2,3-dihydroindol-5-yl]ethyl]benzamide |
| Molecular Formula | C23H25FN2O3 |
| Purity | ≥95% |
| IUPAC Name | 4-fluoro-N-[1-[1-(oxane-4-carbonyl)-2,3-dihydroindol-5-yl]ethyl]benzamide |
| InChI | InChI=1S/C23H25FN2O3/c1-15(25-22(27)16-2-5-20(24)6-3-16)18-4-7-21-19(14-18)8-11-26(21)23(28)17-9-12-29-13-10-17/h2-7,14-15,17H,8-13H2,1H3,(H,25,27) |
| InChIKey | NUBWFWVVKLRSHS-UHFFFAOYSA-N |
| SMILES | CC(C1=CC2=C(C=C1)N(CC2)C(=O)C3CCOCC3)NC(=O)C4=CC=C(C=C4)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
