For research use only. Not for therapeutic Use.
(Rac)-Juvenile Hormone III-d₃（Cat No.:R055039）is a deuterium-labeled synthetic analog of Juvenile Hormone III (JH III), a key hormone in insect development and reproduction. The “racemic” designation indicates a 1:1 mixture of enantiomers, while the incorporation of three deuterium atoms (d₃) enhances its stability and enables precise tracking in biochemical assays. This labeled compound is widely used in entomological and endocrine research to study hormone regulation, metabolism, and signaling pathways in insects. Its isotopic labeling makes it valuable for mass spectrometry and pharmacokinetic studies, aiding in pesticide development and insect physiology research.
| CAS Number | 951116-89-5 |
| Synonyms | trideuteriomethyl (2E,6E)-9-(3,3-dimethyloxiran-2-yl)-3,7-dimethylnona-2,6-dienoate |
| Molecular Formula | C16H23D3O3 |
| Purity | ≥95% |
| IUPAC Name | trideuteriomethyl (2E,6E)-9-(3,3-dimethyloxiran-2-yl)-3,7-dimethylnona-2,6-dienoate |
| InChI | InChI=1S/C16H26O3/c1-12(9-10-14-16(3,4)19-14)7-6-8-13(2)11-15(17)18-5/h7,11,14H,6,8-10H2,1-5H3/b12-7+,13-11+/i5D3 |
| InChIKey | QVJMXSGZTCGLHZ-DGRYHQRESA-N |
| SMILES | [2H]C([2H])([2H])OC(=O)/C=C(\C)/CC/C=C(\C)/CCC1C(O1)(C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
