For research use only. Not for therapeutic Use.
(Rac)-Hexestrol-d6 is a high-purity, deuterium-labeled analog of Hexestrol, a synthetic estrogen used in pharmaceutical research. This racemic mixture, featuring six deuterium atoms, is crucial for studying drug metabolism, pharmacokinetics, and pharmacodynamics. The incorporation of stable heavy isotopes like deuterium enhances the precision and reliability of analytical results. (Rac)-Hexestrol-d6 is invaluable for clinical research and drug development, offering detailed insights into the pharmacokinetic and metabolic profiles of estrogens. Its stable isotope labeling ensures consistent and reproducible data, making it an essential tool for developing more effective and safer estrogen-based therapies. This compound integrates seamlessly into existing experimental protocols, providing a robust solution for high-precision scientific investigations.
| CAS Number | 1215476-12-2 |
| Molecular Formula | C18H16D6O2 |
| Purity | ≥95% |
| Target | Estrogen Receptor/ERR |
| IUPAC Name | 4-[1,1,1,6,6,6-hexadeuterio-4-(4-hydroxyphenyl)hexan-3-yl]phenol |
| InChI | InChI=1S/C18H22O2/c1-3-17(13-5-9-15(19)10-6-13)18(4-2)14-7-11-16(20)12-8-14/h5-12,17-20H,3-4H2,1-2H3/i1D3,2D3 |
| InChIKey | PBBGSZCBWVPOOL-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])CC(C1=CC=C(C=C1)O)C(CC([2H])([2H])[2H])C2=CC=C(C=C2)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |