For research use only. Not for therapeutic Use.
Rac-enterolactone (Cat No.: R051690) is a bioactive lignan metabolite, primarily formed from plant-derived compounds like secoisolariciresinol diglucoside found in flaxseeds, whole grains, and vegetables. It is a potent antioxidant with potential anticancer, anti-inflammatory, and cardioprotective properties. Rac-enterolactone is known to influence estrogenic activity, acting as a phytoestrogen, and may contribute to reduced risks of breast cancer and heart disease. Its ability to modulate cellular processes such as apoptosis and gene expression has made it a subject of interest in health research and disease prevention.
| CAS Number | 78473-71-9 |
| Synonyms | (3R,4R)-rel-Dihydro-3,4-bis[(3-hydroxyphenyl)methyl]-2(3H)-furanone; trans-Dihydro-3,4-bis[(3-hydroxyphenyl)methyl]-2(3H)-Furanone; HPMF; trans-2,3-Bis(3-hydroxybenzyl)-γ-butyrolactone |
| Molecular Formula | C18H18O4 |
| Purity | ≥95% |
| Target | Metabolic Enzyme/Protease |
| Storage | -20°C |
| IUPAC Name | (3R,4R)-3,4-bis[(3-hydroxyphenyl)methyl]oxolan-2-one |
| InChI | 1S/C18H18O4/c19-15-5-1-3-12(8-15)7-14-11-22-18(21)17(14)10-13-4-2-6-16(20)9-13/h1-6,8-9,14,17,19-20H,7,10-11H2/t14-,17+/m0/s1 |
| InChIKey | HVDGDHBAMCBBLR-PBHICJAKSA-N |
| SMILES | C1[C@@H]([C@H](C(=O)O1)CC2=CC(=CC=C2)O)CC3=CC(=CC=C3)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |