For research use only. Not for therapeutic Use.
(Rac)-CP-601927 hydrochloride（Cat No.:I044463）is the racemic form of CP-601927, a small-molecule agonist of the farnesoid X receptor (FXR), a nuclear receptor that regulates bile acid, lipid, and glucose metabolism. The hydrochloride salt enhances the compound’s solubility and stability for research applications. By activating FXR, (Rac)-CP-601927 modulates gene expression involved in bile acid transport, cholesterol clearance, and insulin sensitivity, making it a promising candidate for studying metabolic disorders. It is used in preclinical research on conditions such as non-alcoholic fatty liver disease (NAFLD), NASH, and related metabolic dysfunctions.
| CAS Number | 230615-01-7 |
| Synonyms | 4-(trifluoromethyl)-10-azatricyclo[6.3.1.02,7]dodeca-2(7),3,5-triene;hydrochloride |
| Molecular Formula | C12H13ClF3N |
| Purity | ≥95% |
| IUPAC Name | 4-(trifluoromethyl)-10-azatricyclo[6.3.1.02,7]dodeca-2(7),3,5-triene;hydrochloride |
| InChI | InChI=1S/C12H12F3N.ClH/c13-12(14,15)9-1-2-10-7-3-8(6-16-5-7)11(10)4-9;/h1-2,4,7-8,16H,3,5-6H2;1H |
| InChIKey | ZHTWFWUVFSXTNF-UHFFFAOYSA-N |
| SMILES | C1C2CNCC1C3=C2C=CC(=C3)C(F)(F)F.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
