Home
>
Reference Standards>Chemical Reagents> rac-6-Fluoro-3,4-dihydro-2H-1-benzopyran-2-carboxylic Acid
For research use only. Not for therapeutic Use.
rac-6-Fluoro-3,4-dihydro-2H-1-benzopyran-2-carboxylic acid (Cat No.: R010676) is a racemic mixture of a fluorinated chroman derivative featuring a carboxylic acid group at the 2-position and a fluorine atom at the 6-position of the aromatic ring. The 3,4-dihydro structure introduces flexibility, while the fluorine atom enhances metabolic stability and electronic properties. This compound is used as an intermediate in the synthesis of pharmaceuticals and bioactive molecules, particularly those targeting cardiovascular, neurological, or inflammatory pathways. Its chiral center supports structure-activity relationship (SAR) studies.
| CAS Number | 99199-60-7 |
| Molecular Formula | C10H9FO3 |
| Purity | ≥95% |
| Storage | -80°C |
| IUPAC Name | 6-fluoro-3,4-dihydro-2H-chromene-2-carboxylic acid |
| InChI | InChI=1S/C10H9FO3/c11-7-2-4-8-6(5-7)1-3-9(14-8)10(12)13/h2,4-5,9H,1,3H2,(H,12,13) |
| InChIKey | ZNJANLXCXMVFFI-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=CC(=C2)F)OC1C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |