For research use only. Not for therapeutic Use.
(Rac)-5-Hydroxymethyl Tolterodine（Cat No.:R004933）is the racemic active metabolite of tolterodine, a muscarinic receptor antagonist used in the treatment of overactive bladder. This compound contains equal parts of the (R)- and (S)-enantiomers, both contributing to its pharmacological activity. It selectively inhibits M2 and M3 muscarinic receptors in the bladder, reducing detrusor muscle contractions and improving urinary control. As the primary bioactive form of tolterodine, it plays a central role in its therapeutic effect. (Rac)-5-Hydroxymethyl Tolterodine is also used in research on urinary disorders and muscarinic receptor pharmacology.
| CAS Number | 200801-70-3 |
| Synonyms | 2-[3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-(hydroxymethyl)phenol |
| Molecular Formula | C22H31NO2 |
| Purity | ≥95% |
| IUPAC Name | 2-[3-[di(propan-2-yl)amino]-1-phenylpropyl]-4-(hydroxymethyl)phenol |
| InChI | InChI=1S/C22H31NO2/c1-16(2)23(17(3)4)13-12-20(19-8-6-5-7-9-19)21-14-18(15-24)10-11-22(21)25/h5-11,14,16-17,20,24-25H,12-13,15H2,1-4H3 |
| InChIKey | DUXZAXCGJSBGDW-UHFFFAOYSA-N |
| SMILES | CC(C)N(CCC(C1=CC=CC=C1)C2=C(C=CC(=C2)CO)O)C(C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
