For research use only. Not for therapeutic Use.
RA375（Cat No.:I045825）is a potent small-molecule inhibitor of the ubiquitin-specific protease USP14, a proteasome-associated deubiquitinating enzyme. By blocking USP14 activity, RA375 enhances protein degradation through the ubiquitin–proteasome system, leading to the accumulation of misfolded proteins and induction of cellular stress. This mechanism triggers apoptosis in cancer cells, making RA375 a valuable tool in oncology research. It is also used to investigate proteostasis, protein quality control, and neurodegenerative disease pathways. RA375’s selectivity for USP14 highlights its promise in developing targeted therapeutic strategies.
| CAS Number | 2649154-57-2 |
| Synonyms | N-[(2S)-1-[(3E,5E)-3,5-bis[(4-nitrophenyl)methylidene]-4-oxopiperidin-1-yl]-1-oxo-3-phenylpropan-2-yl]-2-chloroacetamide |
| Molecular Formula | C30H25ClN4O7 |
| Purity | ≥95% |
| IUPAC Name | N-[(2S)-1-[(3E,5E)-3,5-bis[(4-nitrophenyl)methylidene]-4-oxopiperidin-1-yl]-1-oxo-3-phenylpropan-2-yl]-2-chloroacetamide |
| InChI | InChI=1S/C30H25ClN4O7/c31-17-28(36)32-27(16-20-4-2-1-3-5-20)30(38)33-18-23(14-21-6-10-25(11-7-21)34(39)40)29(37)24(19-33)15-22-8-12-26(13-9-22)35(41)42/h1-15,27H,16-19H2,(H,32,36)/b23-14+,24-15+/t27-/m0/s1 |
| InChIKey | REFAVUFYPFWJGH-SWAPHQFDSA-N |
| SMILES | C\1N(C/C(=C\C2=CC=C(C=C2)[N+](=O)[O-])/C(=O)/C1=C/C3=CC=C(C=C3)[N+](=O)[O-])C(=O)[C@@H](NC(=O)CCl)CC4=CC=CC=C4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
