1-Methyl-4-iodoimidazole(CAT: R031429) is a chemical compound with potential applications in various fields, particularly in organic synthesis. Its structure features both a methyl group and an iodine atom on a imidazole ring. This compound’s significance lies in its role as a versatile building block for the preparation of diverse organic molecules. The presence of both a methyl group and an iodine atom in its structure makes it valuable for creating compounds with specific functionalities.
Catalog Number | R031429 |
CAS Number | 71759-87-0 |
Synonyms | 1-Methyl-4-iodoimidazole; 4-Iodo-1-methyl-1H-imidazole; |
Molecular Formula | C4H5IN2 |
Purity | 95% |
Storage | -20°C |
IUPAC Name | 4-iodo-1-methylimidazole |
InChI | InChI=1S/C4H5IN2/c1-7-2-4(5)6-3-7/h2-3H,1H3 |
InChIKey | HUQSHNLGOKQVHA-UHFFFAOYSA-N |
SMILES | CN1C=C(N=C1)I |
Reference | [1]. Properties of haloimidazoles (review)<br /> |